Product Overview
1, 2, 3, 4, 5, 6-Hexabromocyclohexane | T22462 | TargetMol Chemicals
CAS: 1837-91-8
Smiles: BrC1C(Br)C(Br)C(Br)C(Br)C1Br
Formula: C6H6Br6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: The compound effectively and directly inhibits JAK2 tyrosine kinase autophosphorylation and specifically inhibits ligand-dependent JAK2 activation. It has no cytotoxicity at 100 μM. A 16-hour treatment with compound (1 μM) decreases JAK2 tyrosine autophosphorylation levels to ~ 50% while 50 μM eliminates nearly all JAK2 activity.
Molecular Weight: 557, 538