1, 4, 5, 6-Tetrahydroxy-7-prenylxanthone | TN2493

1, 4, 5, 6-Tetrahydroxy-7-prenylxanthone | TN2493 | TargetMol Chemicals

CAS: 1001424-68-5

Smiles: CC(C)=CCc1cc2c(oc3c(O)ccc(O)c3c2=O)c(O)c1O

Formula: C18H16O6

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: 1, 4, 5, 6-Tetrahydroxy-7-prenylxanthone has anti-cancer activity, it shows moderate cytotoxicities against breast cancer (MDA-MB-435S) and lung adenocarcinoma (A549) cell lines; it also exhibits moderate activities with GI50 (Growth inhibitory) values of 2.8 μM against the human leukaemic HL-60 cell line were measured in vitro.

Molecular Weight: 328, 3