10074-A4 | T9628

10074-A4 | T9628 | TargetMol Chemicals

CAS: 312631-87-1

Smiles: OC(CN1C(=O)CSC1=O)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc12

Formula: C18H14Cl2N2O3S

Pathway: Cell Cycle/Checkpoint

Target: c-Myc

Receptor: N/A

Bioactivity: 10074-A4 is a c-Myc binding compound that associates with c-Myc370–409 and behaves like a “ligand cloud” around a “protein cloud”, with distinct features from that of a non-binding ligand.

Molecular Weight: 409, 28