2, 2':5', 2''-Terthiophene | T5650

2, 2':5', 2''-Terthiophene | T5650 | TargetMol Chemicals

CAS: 1081-34-1

Smiles: c1csc(c1)-c1ccc(s1)-c1cccs1

Formula: C12H8S3

Pathway: Microbiology/Virology|||Others

Target: Others|||Antibacterial|||Antibiotic

Receptor: N/A

Bioactivity: 2, 2':5', 2''-Terthiophene (α-Terthiophene) is an oligomer of the heterocycle thiophene. 2, 2':5', 2''-Terthiophene has been employed as building block for the organic semi-conductor polythiophene.

Molecular Weight: 248, 38