2, 3, 23-Trihydroxy-12-oleanen-28-oic acid | TN2684

2, 3, 23-Trihydroxy-12-oleanen-28-oic acid | TN2684 | TargetMol Chemicals

CAS: 102519-34-6

Smiles: CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@@H](O)[C@@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O

Formula: C30H48O5

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: 2β, 3β, 23α-Trihydroxy-12-oleanen-28-oic acid shows cytotoxic activities to human lung adenocarcinoma(A-549)cell lines. 2α, 3β, 23-Trihydroxyolean-12-en-28-oic acid and 2α, 3β, 23-trihydroxyurs-12-en-28-oic acid exhibit cytotoxicity in vitro against the growth of human cancer cells lines HepG-2, with IC50 values of 16.13 ± 3.83, 15.97 ± 2.47 uM, respectively.

Molecular Weight: 488, 7