2, 3, 24-Trihydroxyolean-12-en-28-oic acid | TN2686

2, 3, 24-Trihydroxyolean-12-en-28-oic acid | TN2686 | TargetMol Chemicals

CAS: 150821-16-2

Smiles: CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@@H](O)[C@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O

Formula: C30H48O5

Pathway: Microbiology/Virology

Target: Antifection

Receptor: N/A

Bioactivity: 2α, 3α, 24-Trihydroxyolean-12-en-28-oic acid, a triterpenoid phytoalexin, isolated from peel of unripe fruits of nectarine (Prunus persica cv Fantasia), shows antifungal activity against the fungus mentioned.

Molecular Weight: 488, 7