2, 3, 5, 4'-Tetrahydroxystilbene 2-O-β-D-glucoside | T2964

2, 3, 5, 4'-Tetrahydroxystilbene 2-O-β-D-glucoside | T2964 | TargetMol Chemicals

CAS: 82373-94-2

Smiles: OC[C@H]1O[C@@H](Oc2c(O)cc(O)cc2\C=C\c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O

Formula: C20H22O9

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: (E)-2, 3, 5, 4'-Tetrahydroxy stilbene-2-O-glucoside is a compound isolated from the roots of Polygonum species, inhibits the formation of 5-HETE, HHT and thromboxane B2.

Molecular Weight: 406, 387