Product Overview
2, 3-Dihydro-3-methoxywithaferin A | TN2694 | TargetMol Chemicals
CAS: 21902-96-5
Smiles: COC1CC(=O)[C@]2(C)[C@H]3CC[C@]4(C)C(CC[C@H]4[C@@H]3C[C@H]3O[C@@]23[C@H]1O)[C@H](C)C1CC(C)=C(CO)C(=O)O1
Formula: C29H42O7
Pathway: Cytoskeletal Signaling|||MAPK|||PI3K/Akt/mTOR signaling
Target: MAPK|||Akt
Receptor: N/A
Bioactivity: 2, 3-Dihydro-3-methoxywithaferin A is a natural withanolide, is cytotoxic to human cancer cells, and is a candidate anticancer natural compound. It protects normal cells against stress.
Molecular Weight: 502, 64
