Product Overview
2′, 4, 4′, 6′-Tetrahydroxychalcone | T2S2173 | TargetMol Chemicals
CAS: 73692-50-9
Smiles: Oc1ccc(\C=C\C(=O)c2c(O)cc(O)cc2O)cc1
Formula: C15H12O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Naringenin chalcone has antiallergic activity 2. Naringenin chalcone suppresses asthmatic symptoms by inhibiting Th2 cytokine production from CD4 T cells. 3. Naringenin chalcone is a potent tomato flavonoid that improves adipocyte metabolic functions and exerts insulin-sensitizing effects by activating an adiponectin-related pathway. 4. Naringenin chalcone exhibits anti-inflammatory properties by inhibiting the production of proinflammatory cytokines in the interaction between adipocytes and macrophages, may be useful for ameliorating the inflammatory changes in obese adipose tissue.
Molecular Weight: 272, 256
