Product Overview
2', 7'-Dichlorofluorescein diacetate | T20684 | TargetMol Chemicals
CAS: 2044-85-1
Smiles: CC(=O)Oc1cc2Oc3cc(OC(C)=O)c(Cl)cc3C3(OC(=O)c4ccccc34)c2cc1Cl
Formula: C24H14Cl2O7
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 2', 7'-Dichlorofluorescein diacetate, a cell-permeable fluorogenic probe, is useful for the detection of nitric oxide (NO) and reactive oxygen species (ROS) and for the determination of the degree of overall oxidative stress.
Molecular Weight: 485, 27
