2-Hydroxyeupatolide | TN1212

2-Hydroxyeupatolide | TN1212 | TargetMol Chemicals

CAS: 72229-33-5

Smiles: C\C1=C/[C@H]2OC(=O)C(=C)[C@@H]2[C@H](O)C\C(C)=C\[C@@H](O)C1

Formula: C15H20O4

Pathway: Apoptosis|||NF-Κb|||Others

Target: Others|||TNF|||NF-κB

Receptor: N/A

Bioactivity: 2-Hydroxyeupatolide has anti-inflammatory activity, it may suppress the inflammatory response through inhibiting the activation of NF-κB signaling pathways, and make a contribution to further understanding the pharmaceutical activity of Eupatorium plants.

Molecular Weight: 264, 321