Product Overview
(2S)-Isoxanthohumol | T4S0999 | TargetMol Chemicals
CAS: 70872-29-6
Smiles: COc1cc(O)c(CC=C(C)C)c2O[C@@H](CC(=O)c12)c1ccc(O)cc1
Formula: C21H22O5
Pathway: Microbiology/Virology
Target: Virus Protease|||HSV
Receptor: N/A
Bioactivity: 1. Isoxanthohumol shows an antiviral activity towards herpes viruses (HSV1 and HSV2) and bovine viral diarrhea virus (BVDV). 2. Isoxanthohumol is a polyphenol with antioxidant, anti-inflammatory, and antiangiogenic properties, seems to regulate in vivo vascular proliferation and stabilization and the EC-VSMC-inflammatory crosstalk.
Molecular Weight: 354, 402
