3, 4-Di-O-caffeoylquinic acid methyl ester | TN2872

3, 4-Di-O-caffeoylquinic acid methyl ester | TN2872 | TargetMol Chemicals

CAS: 114637-83-1

Smiles: COC(=O)[C@]1(O)C[C@@H](O)[C@@H](OC(=O)\C=C\c2ccc(O)c(O)c2)[C@@H](C1)OC(=O)\C=C\c1ccc(O)c(O)c1

Formula: C26H26O12

Pathway: Microbiology/Virology

Target: HSV

Receptor: N/A

Bioactivity: 3, 4-Di-O-caffeoylquinic acid methyl ester shows high efficiency and low toxicity with antivirus activity against RSV; it exhibits cytotoxicity actions against human cervix carcinoma HeLa cells.

Molecular Weight: 530, 5