3, 5-Bis(4-nitrophenoxy)benzoic acid | T22678

3, 5-Bis(4-nitrophenoxy)benzoic acid | T22678 | TargetMol Chemicals

CAS: 173550-33-9

Smiles: OC(=O)c1cc(Oc2ccc(cc2)[N+]([O-])=O)cc(Oc2ccc(cc2)[N+]([O-])=O)c1

Formula: C19H12N2O8

Pathway: Neuroscience|||Proteases/Proteasome|||Stem Cells

Target: Gamma-secretase

Receptor: N/A

Bioactivity: The compound is an inhibitor of γ-secretase. It also causes a decrease in the released levels of Aβ42 and notch-1 Aβ-like peptide 25 (Nβ25).

Molecular Weight: 396, 311