Product Overview
3, 5-Diiodothyropropionic acid | T13492 | TargetMol Chemicals
CAS: 1158-10-7
Smiles: OC(=O)CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1
Formula: C15H12I2O4
Pathway: Endocrinology/Hormones
Target: Thyroid hormone receptor(THR)
Receptor: N/A
Bioactivity: 3, 5-Diiodothyropropionic acid is a thyroid hormone analog. It induces α-myosin heavy chain mRNA expression, binds to thyroid hormone receptor (Ka: 2.40/M and 4.06/M for TRα1 and TRβ1).
Molecular Weight: 510, 066
