Product Overview
3-Dehydrotrametenolic acid | T5S0620 | TargetMol Chemicals
CAS: 29220-16-4
Smiles: CC(C)=CCC[C@H]([C@H]1CC[C@@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]12C)C(O)=O
Formula: C30H46O3
Pathway: Apoptosis|||Metabolism|||Others
Target: Apoptosis|||Others|||Dehydrogenase
Receptor: N/A
Bioactivity: 1. Dehydrotrametenolic acid can be a potential anticancer agent against H-ras transformed tumor. 2. Dehydrotrametenolic acid is a promising candidate for a new type of insulin-sensitizing drug.
Molecular Weight: 454, 695
