3'-Demethylnobiletin | TN1244

3'-Demethylnobiletin | TN1244 | TargetMol Chemicals

CAS: 112448-39-2

Smiles: COc1ccc(cc1O)-c1cc(=O)c2c(OC)c(OC)c(OC)c(OC)c2o1

Formula: C20H20O8

Pathway: Cell Cycle/Checkpoint|||Cytoskeletal Signaling|||DNA Damage/DNA Repair|||Metabolism|||NF-Κb

Target: LDL|||NF-κB|||Integrin|||Lipoxygenase|||DNA/RNA Synthesis

Receptor: N/A

Bioactivity: 3'-Demethylnobiletin has chemopreventive effects on colon carcinogenesis, it can significantly inhibit the growth of human colon cancer cells, cause cell-cycle arrest, induce apoptosis, and profoundly modulate signaling proteins related with cell proliferation and cell death.

Molecular Weight: 388, 372