3-Deoxyaconitine | T4S1876

3-Deoxyaconitine | T4S1876 | TargetMol Chemicals

CAS: 3175-95-9

Smiles: CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34[C@@H]5C[C@@]6(O)[C@H](OC(=O)c7ccccc7)[C@@H]5[C@@](OC(C)=O)([C@@H]([C@H](OC)[C@H]23)C14)[C@@H](O)[C@@H]6OC

Formula: C34H47NO10

Pathway: Membrane transporter/Ion channel

Target: Sodium Channel

Receptor: N/A

Bioactivity: 3- Deoxyaconitine is a derivative of Aconitine (A189875), which activates tetrodotoxin-sensitive Na+ channels, inducing presynaptic depolarization, thus blocking the nerve action potential which, in turn, blocks the release of neurotransmitters and decreases the end plate potential at the neuromuscular junction.

Molecular Weight: 629, 747