3-Deoxyglucosone | T19117

3-Deoxyglucosone | T19117 | TargetMol Chemicals

CAS: 4084-27-9

Smiles: OC[C@@H](O)[C@@H](O)CC(=O)C=O

Formula: C6H10O5

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: 3-Deoxyglucosone rapidly reacts with protein amino groups to form advanced glycation end products (AGEs). It synergizes with low glucose to potentiate GLP-1 secretion and is considered as a biomarker for diabetes.

Molecular Weight: 162, 141