Product Overview
3-Deoxyglucosone | T19117 | TargetMol Chemicals
CAS: 4084-27-9
Smiles: OC[C@@H](O)[C@@H](O)CC(=O)C=O
Formula: C6H10O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 3-Deoxyglucosone rapidly reacts with protein amino groups to form advanced glycation end products (AGEs). It synergizes with low glucose to potentiate GLP-1 secretion and is considered as a biomarker for diabetes.
Molecular Weight: 162, 141
