(+)-(3R, 8S)-Falcarindiol | T5S1285

(+)-(3R, 8S)-Falcarindiol | T5S1285 | TargetMol Chemicals

CAS: 225110-25-8

Smiles: CCCCCCC\C=C/[C@H](O)C#CC#C[C@H](O)C=C

Formula: C17H24O2

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: 1. Falcarindiol is a potential new anticancer agent that exerts its activity through inducing ER stress and apoptosis. 2. Falcarindiol induces immunosuppressive effects in vitro and in vivo and might be a novel therapy for autoimmune or allergic diseases. 3. Falcarindiol has protective effect against CCl(4) toxicity, in part, be explained by anti-lipid peroxidation activity associated with the induction of the GSTs including GSTA4.

Molecular Weight: 260, 377