Product Overview
5-Feruloylquinic acid | TN1296 | TargetMol Chemicals
CAS: 40242-06-6
Smiles: COc1cc(C=CC(=O)O[C@@H]2C[C@](O)(C[C@@H](O)[C@@H]2O)C(O)=O)ccc1O
Formula: C17H20O9
Pathway: Chromatin/Epigenetic|||DNA Damage/DNA Repair|||Proteases/Proteasome
Target: Tyrosinase|||Sirtuin
Receptor: N/A
Bioactivity: 5-O-Feruloylquinic acid is a potent Sirt1 agonist, it is a potential lead compound that can be further tested in drug development process for diseases associated with aging.
Molecular Weight: 368, 338
