Product Overview
5-fluoro 203 | T21704 | TargetMol Chemicals
CAS: 260443-89-8
Smiles: Cc1cc(ccc1N)-c1nc2cc(F)ccc2s1
Formula: C14H11FN2S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 5-fluoro 203 is a cytotoxic molecule leading to cell death by forming DNA adducts. 5-fluoro 203 induces aryl hydrocarbon receptor signaling, and elevates expression of CYP1A1. 5-fluoro 203 treatment of cells also leads to elevation of reactive oxygen species and activation of p38, JNK and ERK.
Molecular Weight: 258, 31
![5'-Deoxy-5-fluoro-N-[(pentyloxy)carbonyl]cytidine 2', 3'-diacetate](https://cdn11.bigcommerce.com/s-2kvb5rm600/images/stencil/500x659/products/47552/44208/TargetMol-768x384__12443.1665998863__02671.1666031977.png?c=1 "5'-Deoxy-5-fluoro-N-[(pentyloxy)carbonyl]cytidine 2', 3'-diacetate")
