Product Overview
5-methoxy-α-Ethyltryptamine | T9746 | TargetMol Chemicals
CAS: 4765-10-0
Smiles: CCC(N)Cc1c[nH]c2ccc(OC)cc12
Formula: C13H18N2O
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 5-Methoxy-alpha-ethyltryptamine is a psychoactive substance that can cause various effects. It belongs to the tryptamine chemical class and can be used for various psychoactive and stimulant effects.
Molecular Weight: 218, 3
