6-Hydroxy-1, 2, 3, 7-tetramethoxyxanthone | TN3171

TargetMol Chemicals

(No reviews yet) Write a Review

€543.00

Current Stock:

Quantity:

Adding to cart… The item has been added

6-Hydroxy-1, 2, 3, 7-tetramethoxyxanthone | TN3171 | TargetMol Chemicals

CAS: 64756-87-2

Smiles: COc1cc2c(cc1O)oc1cc(OC)c(OC)c(OC)c1c2=O

Formula: C17H16O7

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: 6-Hydroxy-1, 2, 3, 7-tetramethoxyxanthone is a natural product from Polygala sibirica L.

Molecular Weight: 332, 3

(No reviews yet) Write a Review