Product Overview
7-epi-Taxol | T3S2372 | TargetMol Chemicals
CAS: 105454-04-4
Smiles: CC(=O)O[C@@H]1C2=C(C)[C@H](C[C@@](O)([C@@H](OC(=O)c3ccccc3)[C@@H]3[C@@]4(CO[C@@H]4C[C@@H](O)[C@@]3(C)C1=O)OC(C)=O)C2(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1
Formula: C47H51NO14
Pathway: Cytoskeletal Signaling|||Others
Target: Others|||Microtubule Associated
Receptor: N/A
Bioactivity: 1. 7-Epitaxol is the major derivative of taxol found in cells and that its presence does not alter, in a major way, the overall biological activity of taxol.
Molecular Weight: 853, 918
