Product Overview
7ACC1 | T5845 | TargetMol Chemicals
CAS: 50995-74-9
Smiles: CCN(CC)c1ccc2cc(C(O)=O)c(=O)oc2c1
Formula: C14H15NO4
Pathway: Membrane transporter/Ion channel
Target: Monocarboxylate transporter
Receptor: N/A
Bioactivity: 7-(Diethylamino)coumarin-3-carboxylic acid(7ACC) selectively affects a single part of the MCT symporter translocation cycle, leading to strict inhibition of lactate influx. This singular activity is associated with antitumor effects less prone to resistance and side effects.
Molecular Weight: 261, 277
