8-Gingerol | T6S1684

8-Gingerol | T6S1684 | TargetMol Chemicals

CAS: 23513-08-8

Smiles: CCCCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1

Formula: C19H30O4

Pathway: Membrane transporter/Ion channel|||Microbiology/Virology|||oxidation-reduction

Target: Antioxidant|||Antibacterial|||TRP/TRPV Channel

Receptor: N/A

Bioactivity: 1. 8-Gingerol has antioxidant activity. 2. 8-Gingerol has antimycobacterial activity. 3. 8-Gingerol could be used as an effective skin-whitening agent. 4. 8-Gingerol shows antipyretic and anti-inflammation characteristics. 5. 8-Gingerol seems to be effective in an animal model of rheumatoid arthritis. 6. 8-Gingerol inhibits the anti-serotonin 3 receptor function, exhibits cardiotonic activity. 7. 8-Gingerol affects gastric motility and potentially have an antispasmodic effect on the gastrointestinal system. 8. 8-gingerol inhibited melanogenesis in B16F1 and B16F1 cells by down-regulation of both mitogen-activated protein kinases (MAPK) and protein kinase A (PKA) signaling pathways or through its antioxidant properties.

Molecular Weight: 322, 445