Product Overview
AA147 | T14080 | TargetMol Chemicals
CAS: 393121-74-9
Smiles: Cc1ccc(O)c(NC(=O)CCc2ccccc2)c1
Formula: C16H17NO2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: AA147 is a small molecule endoplasmic reticulum (ER) proteostasis regulator. The selectively activates ATF6 arm of the unfolded protein response (UPR) .It acts as a prodrug that preferentially triggers ATF6 signaling through a mechanism involving localized metabolic activation and selective covalent modification of ER resident proteins that regulate ATF6 activity.
Molecular Weight: 255, 317