Product Overview
Acevaltrate | TJP2872 | TargetMol Chemicals
CAS: 25161-41-5
Smiles: CC(C)CC(=O)O[C@@H]1OC=C(COC(C)=O)C2=C[C@H](OC(=O)CC(C)(C)OC(C)=O)[C@]3(CO3)[C@@H]12
Formula: C24H32O10
Pathway: Membrane transporter/Ion channel|||Others
Target: ATPase|||Others
Receptor: N/A
Bioactivity: 1. Acevaltrate displays high cytotoxicity against GLC(4), a human small-cell lung cancer cell line, and against COLO 320, a human colorectal cancer cell line, with IC50 values of 1-6 uM.
Molecular Weight: 480, 51