Product Overview
Adenylosuccinic acid | T14129 | TargetMol Chemicals
CAS: 19046-78-7
Smiles: O[C@@H]1[C@@H](COP(O)(O)=O)O[C@H]([C@@H]1O)n1cnc2c(N[C@@H](CC(O)=O)C(O)=O)ncnc12
Formula: C14H18N5O11P
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Adenylosuccinic acid (Adenylosuccinate; Aspartyl adenylate) is a purine ribonucleoside monophosphate and plays a role in nucleotide cycle metabolite. Adenylosuccinic acid has the potential for the study of duchenne muscular dystrophy(DMD)[1] and can be converted into fumaric acid through adenylosuccinate lyase.
Molecular Weight: 463, 296
