Product Overview
Albiflorin | T6S1653 | TargetMol Chemicals
CAS: 39011-90-0
Smiles: C[C@]12C[C@@H](O)[C@@H]3C[C@@]1(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C3(COC(=O)c1ccccc1)C(=O)O2
Formula: C23H28O11
Pathway: Immunology/Inflammation|||Metabolism|||NF-Κb
Target: Reactive Oxygen Species
Receptor: N/A
Bioactivity: 1. Albiflorin has anticonvulsant effect for pain relief. 2. Albiflorin and paeoniflorin has neuroprotective action against Glu toxicity. 3. Albiflorin and paeoniflorin significantly ameliorated Glu-induced reduction of cell viability, nuclear and mitochondrial apoptotic alteration, reactive oxygen species accumulation and B-cell lymphoma 2 (Bcl-2)/Bax ratio. 4. Albiflorin can serve as a new chemical marker for the quality control of Paeoniae Radix and the Chinese Pharmacopoeia can be updated, via has similar anti-inflammatory effects to paeoniflorin.
Molecular Weight: 480, 466
