Product Overview
Aldosterone | T19186 | TargetMol Chemicals
CAS: 52-39-1
Smiles: C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@]3(C[C@H](O)[C@H]21)C=O
Formula: C21H28O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Aldosterone is the primary mineralocorticoid. Aldosterone is synthesized and secreted in response to renin-angiotensin system activation or high dietary potassium by the zona glomerulosa of the adrenal cortex.
Molecular Weight: 360, 45
