Product Overview
ALLO-1 | T19188 | TargetMol Chemicals
CAS: 37468-32-9
Smiles: CC1N(Cc2ccccc2)C(=O)N(C1=O)c1ccc(Cl)cc1
Formula: C17H15ClN2O2
Pathway: Autophagy
Target: Autophagy
Receptor: N/A
Bioactivity: ALLO-1 is an autophagy receptor and is essential for autophagosome formation around paternal organelles and directly binds to the worm LC3 homologue LGG-1 through its LC3-interacting region (LIR) motif.
Molecular Weight: 314, 77
