Product Overview
Amorolfine HCL | T8812 | TargetMol Chemicals
CAS: 106614-68-0
Smiles: Cl.CCC(C)(C)c1ccc(CC(C)CN2CC(C)OC(C)C2)cc1
Formula: C21H36ClNO
Pathway: Microbiology/Virology
Target: Antibiotic
Receptor: N/A
Bioactivity: Amorolfine HCL is an antifungal reagent. It exerts the antifungal activity by selectively interrupting two steps in the pathway of ergosterol synthesis and eventually disrupting the function and structure of fungal cell membrane. Amorolfine, a morpholine antifungal drug, can inhibit D14 reductase and D7-D8 isomerase. These enzymes can deplete ergosterol and cause ignosterol to accumulate in the fungal cytoplasmic cell membranes.
Molecular Weight: 353, 98
