Product Overview
Angiotensin 1/2 (2-7) | T22573 | TargetMol Chemicals
CAS: T22573
Smiles: N[C@@H](CCCNC(N)=N)C(N[C@@H](C(C)C)C(N[C@@H](CC1=CC=C(O)C=C1)C(N[C@@H]([C@H](C)CC)C(N[C@@H](CC2=CNC=N2)C(N3CCC[C@@H]3C(O)=O)=O)=O)=O)=O)=O
Formula: C37H57N11O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Angiotensin I/II (2-7) is a peptide that contains the amino acids 2-7 and is converted from Angiotensin I/II peptide. Angiotensin is a peptide hormone that causes vasoconstriction and a subsequent increase in blood pressure. Angiotensin also stimulates the release of aldosterone, which promotes sodium retention in the distal nephron, thereby increasing blood pressure.
Molecular Weight: 783, 92
