Product Overview
β-Anhydroicaritin | T6S2140 | TargetMol Chemicals
CAS: 38226-86-7
Smiles: COc1ccc(cc1)-c1oc2c3CCC(C)(C)Oc3cc(O)c2c(=O)c1O
Formula: C21H20O6
Pathway: Apoptosis|||Immunology/Inflammation|||Others|||Proteases/Proteasome
Target: MMP|||Others|||TNF|||Interleukin
Receptor: N/A
Bioactivity: 1. Anhydroicaritin exhibits immunosuppressive effect on the mouse macrophages stimulated by LPS. 2. Anhydroicaritin phytosomes can inhibit enhanced bone turnover induced by ovariectomy, improve BMD the biomechanical properties of vertebrae, without any stimulation on uterus. 3. Anhydroicaritin possesses significant protective effects on the zymosan-induced peritonitis mice, which might be associated with the regulation of Ca(2+); influx in macrophages and iNOS expression.
Molecular Weight: 368, 385
