Product Overview
(-)-Anonaine | TN1393 | TargetMol Chemicals
CAS: 1862-41-5
Smiles: C1Oc2cc3CCN[C@@H]4Cc5ccccc5-c(c2O1)c34
Formula: C17H15NO2
Pathway: Apoptosis|||Proteases/Proteasome
Target: BCL|||Caspase|||p53
Receptor: N/A
Bioactivity: (-)-Anonaine has some anticancer activity, it induces apoptosis through Bax- and caspase-dependent pathways in human cervical cancer (HeLa) cells, it induces DNA damage and inhibits growth and migration of human lung carcinoma h1299 cells.
Molecular Weight: 265, 312
