Product Overview
AQC | TD0101 | TargetMol Chemicals
CAS: 148757-94-2
Smiles: O=C(Nc1ccc2ncccc2c1)ON1C(=O)CCC1=O
Formula: C14H11N3O4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: AQC (6-Aminoquinolyl-N-hydroxysccinimidyl carbamate) is a reagent for the fluorescence detection of amino acid or protein sequence by HPLC. AQC reacts with primary and secondary amino acids to produce fluorescent derivatives, allowing the detection of amino acids at picomolar levels.
Molecular Weight: 285, 259
