Product Overview
Aquacycline | T50026 | TargetMol Chemicals
CAS: 423769-22-6
Smiles: Cl.CN(C)[C@H]1C2[C@@H](O)C3C(=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)cccc1[C@@]3(C)O
Formula: C22H25ClN2O9
Pathway: Microbiology/Virology
Target: HSV
Receptor: N/A
Bioactivity: Oxytetracycline (OTC) is a broad-spectrum antibiotic that acts by inhibiting protein synthesis in bacteria. Oxytetracycline prevents the binding from aminoacil-tRNA to the complex m-ribosomal RNA. Oxytetracycline also possesses anti-HSV-1 activity[1][2][3].
Molecular Weight: 496, 895