Product Overview
Argiprestocin | T3443 | TargetMol Chemicals
CAS: 9034-50-8
Smiles: CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(N)=O
Formula: C43H67N15O12S2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Vasopressin, also called antidiuretic hormone that plays a key role in maintaining osmolality. It is a neurohypophysial hormone found in most mammals. Drugs used to cause constriction of the blood vessels.
Molecular Weight: 1050, 22
