Product Overview
Artemisic acid | T4S1452 | TargetMol Chemicals
CAS: 80286-58-4
Smiles: C[C@@H]1CC[C@H]([C@H]2C=C(C)CC[C@@H]12)C(=C)C(O)=O
Formula: C15H22O2
Pathway: Microbiology/Virology
Target: Antibacterial
Receptor: N/A
Bioactivity: 1. Artemisinic acid shows antibacterial activity. 2. Artemisinic acid is a major precursor of artemisinin (an antimalaric compound), isolated as the active principles of the medicinal plant Artemisia annua L.
Molecular Weight: 234, 339
