Product Overview
Artemitin | TCS1704 | TargetMol Chemicals
CAS: 479-90-3
Smiles: COc1ccc(cc1OC)-c1oc2cc(OC)c(OC)c(O)c2c(=O)c1OC
Formula: C20H20O8
Pathway: oxidation-reduction
Target: Antioxidant
Receptor: N/A
Bioactivity: 1. Artemetin has anti-inflammatory activity. 2. Artemetin protects endothelial function by acting as antioxidant and antiapoptotic agent and through the activation of ERK1/2 and Akt. 3. Intravenous injection of Artemetin (.75 mg/kg) significantly reduces the hypertensive response to angiotensin I while increases the average length of bradykinin-induced hypotension.
Molecular Weight: 388, 372