Product Overview
Aspartic acid calcium | T8267 | TargetMol Chemicals
CAS: 10389-09-0
Smiles: [Ca++].NC(CC([O-])=O)C([O-])=O
Formula: C4H5CaNO4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Aspartic acid calcium (Calcium L-aspartate) is a chelate where calcium is attached to an amino acid naming L-Aspartic acid, which is an amino acid and serves as a building block for proteins in the body.
Molecular Weight: 171, 165
