Product Overview
Astragalin | T6S1101 | TargetMol Chemicals
CAS: 480-10-4
Smiles: OC[C@H]1O[C@@H](Oc2c(oc3cc(O)cc(O)c3c2=O)-c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O
Formula: C21H20O11
Pathway: Apoptosis|||NF-Κb
Target: Apoptosis|||NF-κB
Receptor: N/A
Bioactivity: 1. Astragalin may be a potential agent in the treatment of osteoarthritis. 2. Astragalin can be effective in allaying ROS-promoted bronchial fibrosis through inhibiting autophagosome formation in airways. 3. Astragalin ameliorates oxidative stress-associated epithelial eosinophilia and apoptosis through disturbing TLR4-PKCβ2-NADPH oxidase-responsive signaling. 4. Astragalin exerts anti-inflammatory properties possibly via the inactivation of TLR4-mediated NF-κB and mitogen-activated protein kinases signaling pathways in LPS-stimulated mMECs. 5. Astragalin exerts anti-inflammatory properties in LPS-mediated mastitis, possibly through inhibiting inhibition of the NF-κB signaling pathway, which mediates the expression of pro-inflammatory cytokines.
Molecular Weight: 448, 38
