Product Overview
Aurantio-obtusin | T6S1559 | TargetMol Chemicals
CAS: 67979-25-3
Smiles: COc1c(O)cc2C(=O)c3cc(C)c(O)c(OC)c3C(=O)c2c1O
Formula: C17H14O7
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Biotransformation of glucoAurantio-obtusin towards Aurantio-obtusin increased the toxicity of irinotecan through increased inhibition of SN-38 glucuronidation. 2. Aurantio-obtusin, stimulated chemotactic migration of MC3T3-E1 osteoblast cells in a concentration-dependent manner. Besides migration, the compound stimulated osteoblast differentiation and mineralization. 3. Aurantio-obtusin is a promising osteoanabolic compound of natural origin with potential therapeutic applications in the prevention of osteoporosis and other metabolic bone diseases.
Molecular Weight: 330, 292
