Product Overview
AUY-954 free base | T30215 | TargetMol Chemicals
CAS: 820240-77-5
Smiles: OC(=O)CCNCc1ccc2sc(cc2c1)-c1ccc(-c2ccccc2)c(c1)C(F)(F)F
Formula: C25H20F3NO2S
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: AUY-954 is an effective selective S1P(1) modulator. It can significantly reduce the local expression of EAN rat sciatic nerve T cells, B cells, macrophage infiltration, inflammatory demyelination, interleukin-17 and matrix metalloproteinase-9.
Molecular Weight: 455, 5
