Product Overview
Avicularin | T6S0117 | TargetMol Chemicals
CAS: 572-30-5
Smiles: OC[C@@H]1O[C@@H](Oc2c(oc3cc(O)cc(O)c3c2=O)-c2ccc(O)c(O)c2)[C@H](O)[C@H]1O
Formula: C20H18O11
Pathway: MAPK
Target: ERK
Receptor: N/A
Bioactivity: 1. Avicularin exhibits anti-inflammatory activity through the suppression of ERK signaling pathway in LPS-stimulated RAW 264.7 macrophage cells. 2. Avicularin inhibits the accumulation of the intracellular lipids by decreasing C/EBPα-activated GLUT4-mediated glucose uptake in adipocytes and potently inhibiting fatty acid synthase.
Molecular Weight: 434, 35
