AY 9944 | T14362

AY 9944 | T14362 | TargetMol Chemicals

CAS: 366-93-8

Smiles: Cl.Cl.Clc1ccccc1CNC[C@H]1CC[C@H](CNCc2ccccc2Cl)CC1

Formula: C22H30Cl4N2

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: AY 9944 is a specific cholesterol biosynthesis inhibitor. AY 9944 inhibits the 7-dehydro cholesterol Δ7-reductase (DHCR7) enzyme (IC50=13 nM). At high doses, AY 9944 inhibits also in cultured embryos sterol Δ7-Δ8 isomerase, which causes the accumulation of cholest-8-en-3β-ol[1][2][3]. AY 9944 causes hypocholesterolemia and accumulation of 7DHC.

Molecular Weight: 464, 3