Product Overview
Azure B | T18918 | TargetMol Chemicals
CAS: 531-55-5
Smiles: [Cl-].CNc1ccc2nc3ccc(cc3[s+]c2c1)N(C)C
Formula: C15H16ClN3S
Pathway: Metabolism|||Neuroscience
Target: MAO|||Monoamine Oxidase
Receptor: N/A
Bioactivity: Azure B is a cationic dye and the major metabolite of Methylene blue. Azure B is a selective, and reversible inhibitor of MAO-A (IC50s: 11 and 968 nM for recombinant human MAO-A and MAO-B).
Molecular Weight: 305, 82
