Product Overview
Bardoxolone | T2915 | TargetMol Chemicals
CAS: 218600-44-3
Smiles: CC1(C)CC[C@@]2(CC[C@]3(C)[C@@H]([C@@H]2C1)C(=O)C=C1[C@@]2(C)C=C(C#N)C(=O)C(C)(C)[C@@H]2CC[C@@]31C)C(O)=O
Formula: C31H41NO4
Pathway: Immunology/Inflammation|||Others
Target: Others|||Nrf2
Receptor: N/A
Bioactivity: CDDO is a synthetic oleanane triterpenoid that blocks the cellular synthesis of inducible nitric oxide synthase and inducible COX-2 in INF-γ-activated mouse macrophages with an IC50 value of 0.4 nM. By suppressing reactive oxygen and nitrogen species (ROS/RNS) formation, it promotes the cellular control of ROS/RNS levels that would lead to DNA damage associated with tumorigenesis. In various Y cell lines, CDDO has been shown to specifically inhibit proliferation and induce apoptosis. Mechanism studies revealed that CDDO is a ligand for peroxisome proliferator-activated receptor γ, and also that it induces genes regulated by Nrf2, including heme oxygenase-1 and eotaxin-1, which play a role in antioxidant response element signaling activity.
Molecular Weight: 491, 672
